C16H21N3O5 — CID 118771882
1-[(3S,4R)-4-ethoxyoxolan-3-yl]-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea (PubChem CID 118771882) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-[(3S,4R)-4-ethoxyoxolan-3-yl]-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea.
| Compound Name | 1-[(3S,4R)-4-ethoxyoxolan-3-yl]-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 118771882 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[(3S,4R)-4-ethoxyoxolan-3-yl]-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]urea |
| SMILES | CCO[C@H]1COC[C@@H]1NC(=O)Nc1cccc(N2CCOC2=O)c1 |
| InChI | InChI=1S/C16H21N3O5/c1-2-23-14-10-22-9-13(14)18-15(20)17-11-4-3-5-12(8-11)19-6-7-24-16(19)21/h3-5,8,13-14H,2,6-7,9-10H2,1H3,(H2,17,18,20)/t13-,14-/m0/s1 |
| InChIKey | YOUDLBHUXMRMAJ-KBPBESRZSA-N |
| XLogP | 1.57 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |