C14H18ClNO3 — CID 122559839
4-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]-3-methylbenzamide (PubChem CID 122559839) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is 4-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]-3-methylbenzamide.
| Compound Name | 4-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 122559839 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4-chloro-N-[(3S,4R)-4-ethoxyoxolan-3-yl]-3-methylbenzamide |
| SMILES | CCO[C@H]1COC[C@@H]1NC(=O)c1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C14H18ClNO3/c1-3-19-13-8-18-7-12(13)16-14(17)10-4-5-11(15)9(2)6-10/h4-6,12-13H,3,7-8H2,1-2H3,(H,16,17)/t12-,13-/m0/s1 |
| InChIKey | XQSRMMDVDUREMR-STQMWFEESA-N |
| XLogP | 2.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |