C19H24N2O3 — CID 118778216
N-[(3S,4R)-4-ethoxyoxolan-3-yl]-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide (PubChem CID 118778216) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[(3S,4R)-4-ethoxyoxolan-3-yl]-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide.
| Compound Name | N-[(3S,4R)-4-ethoxyoxolan-3-yl]-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide |
|---|---|
| PubChem CID | 118778216 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[(3S,4R)-4-ethoxyoxolan-3-yl]-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide |
| SMILES | CCO[C@H]1COC[C@@H]1NC(=O)c1ccc2c3c([nH]c2c1)CCCC3 |
| InChI | InChI=1S/C19H24N2O3/c1-2-24-18-11-23-10-17(18)21-19(22)12-7-8-14-13-5-3-4-6-15(13)20-16(14)9-12/h7-9,17-18,20H,2-6,10-11H2,1H3,(H,21,22)/t17-,18-/m0/s1 |
| InChIKey | ULAFDMFKMDZEMF-ROUUACIJSA-N |
| XLogP | 2.58 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|