C18H25NO5 — CID 46982922
3-ethoxy-N-[(3S,4R)-4-ethoxyoxolan-3-yl]-4-prop-2-enoxybenzamide (PubChem CID 46982922) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 3-ethoxy-N-[(3S,4R)-4-ethoxyoxolan-3-yl]-4-prop-2-enoxybenzamide.
| Compound Name | 3-ethoxy-N-[(3S,4R)-4-ethoxyoxolan-3-yl]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 46982922 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-ethoxy-N-[(3S,4R)-4-ethoxyoxolan-3-yl]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N[C@H]2COC[C@@H]2OCC)cc1OCC |
| InChI | InChI=1S/C18H25NO5/c1-4-9-24-15-8-7-13(10-16(15)22-5-2)18(20)19-14-11-21-12-17(14)23-6-3/h4,7-8,10,14,17H,1,5-6,9,11-12H2,2-3H3,(H,19,20)/t14-,17-/m0/s1 |
| InChIKey | HREINCXDCBMEDM-YOEHRIQHSA-N |
| XLogP | 2.18 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|