C18H25NO3 — CID 100533999
N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3,4-diethoxybenzamide (PubChem CID 100533999) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3,4-diethoxybenzamide.
| Compound Name | N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 100533999 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N[C@@H]2C[C@H]3CC[C@@H]2C3)cc1OCC |
| InChI | InChI=1S/C18H25NO3/c1-3-21-16-8-7-14(11-17(16)22-4-2)18(20)19-15-10-12-5-6-13(15)9-12/h7-8,11-13,15H,3-6,9-10H2,1-2H3,(H,19,20)/t12-,13+,15+/m0/s1 |
| InChIKey | NLOQAVZHSAASMI-GZBFAFLISA-N |
| XLogP | 3.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |