C21H26N2O4 — CID 134705516
3,4-diethoxy-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide (PubChem CID 134705516) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3,4-diethoxy-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide.
| Compound Name | 3,4-diethoxy-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 134705516 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3,4-diethoxy-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)N[C@@H]2COC[C@H]2Cc2ccncc2)cc1OCC |
| InChI | InChI=1S/C21H26N2O4/c1-3-26-19-6-5-16(12-20(19)27-4-2)21(24)23-18-14-25-13-17(18)11-15-7-9-22-10-8-15/h5-10,12,17-18H,3-4,11,13-14H2,1-2H3,(H,23,24)/t17-,18-/m1/s1 |
| InChIKey | FPIAOUJNUAVIDU-QZTJIDSGSA-N |
| XLogP | 2.87 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |