C19H22N2O4 — CID 134695838
3,5-dimethoxy-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide (PubChem CID 134695838) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 134695838 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3,5-dimethoxy-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N[C@H]2COC[C@H]2Cc2ccncc2)c1 |
| InChI | InChI=1S/C19H22N2O4/c1-23-16-8-14(9-17(10-16)24-2)19(22)21-18-12-25-11-15(18)7-13-3-5-20-6-4-13/h3-6,8-10,15,18H,7,11-12H2,1-2H3,(H,21,22)/t15-,18+/m1/s1 |
| InChIKey | YZJLIEYMCHWBCL-QAPCUYQASA-N |
| XLogP | 2.09 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |