C21H26N2O2 — CID 135106892
4-tert-butyl-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide (PubChem CID 135106892) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-tert-butyl-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 135106892 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4-tert-butyl-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N[C@@H]2COC[C@H]2Cc2ccncc2)cc1 |
| InChI | InChI=1S/C21H26N2O2/c1-21(2,3)18-6-4-16(5-7-18)20(24)23-19-14-25-13-17(19)12-15-8-10-22-11-9-15/h4-11,17,19H,12-14H2,1-3H3,(H,23,24)/t17-,19-/m1/s1 |
| InChIKey | FLUHHLUDPMLQIE-IEBWSBKVSA-N |
| XLogP | 3.37 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |