C22H27N3O2 — CID 135096933
4-piperidin-1-yl-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide (PubChem CID 135096933) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 4-piperidin-1-yl-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide.
| Compound Name | 4-piperidin-1-yl-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 135096933 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 4-piperidin-1-yl-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1COC[C@H]1Cc1ccncc1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H27N3O2/c26-22(18-4-6-20(7-5-18)25-12-2-1-3-13-25)24-21-16-27-15-19(21)14-17-8-10-23-11-9-17/h4-11,19,21H,1-3,12-16H2,(H,24,26)/t19-,21-/m1/s1 |
| InChIKey | RVQDMOQFRYFKGK-TZIWHRDSSA-N |
| XLogP | 3.06 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |