C16H22N2O2 — CID 135107014
N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]cyclopentanecarboxamide (PubChem CID 135107014) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]cyclopentanecarboxamide.
| Compound Name | N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 135107014 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]cyclopentanecarboxamide |
| SMILES | O=C(N[C@H]1COC[C@H]1Cc1ccncc1)C1CCCC1 |
| InChI | InChI=1S/C16H22N2O2/c19-16(13-3-1-2-4-13)18-15-11-20-10-14(15)9-12-5-7-17-8-6-12/h5-8,13-15H,1-4,9-11H2,(H,18,19)/t14-,15+/m1/s1 |
| InChIKey | WOOBVXROBJSXSG-CABCVRRESA-N |
| XLogP | 1.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |