C17H24N2O2 — CID 135101855
2-cyclopentyl-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]acetamide (PubChem CID 135101855) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 135101855 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-cyclopentyl-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]acetamide |
| SMILES | O=C(CC1CCCC1)N[C@H]1COC[C@H]1Cc1ccncc1 |
| InChI | InChI=1S/C17H24N2O2/c20-17(10-13-3-1-2-4-13)19-16-12-21-11-15(16)9-14-5-7-18-8-6-14/h5-8,13,15-16H,1-4,9-12H2,(H,19,20)/t15-,16+/m1/s1 |
| InChIKey | GRFAPRLRQLAPQS-CVEARBPZSA-N |
| XLogP | 2.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |