C15H22N2O3 — CID 134712034
3-ethoxy-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]propanamide (PubChem CID 134712034) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-ethoxy-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]propanamide.
| Compound Name | 3-ethoxy-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]propanamide |
|---|---|
| PubChem CID | 134712034 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-ethoxy-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]propanamide |
| SMILES | CCOCCC(=O)N[C@@H]1COC[C@H]1Cc1ccncc1 |
| InChI | InChI=1S/C15H22N2O3/c1-2-19-8-5-15(18)17-14-11-20-10-13(14)9-12-3-6-16-7-4-12/h3-4,6-7,13-14H,2,5,8-11H2,1H3,(H,17,18)/t13-,14-/m1/s1 |
| InChIKey | ITDBULRCDBMJAS-ZIAGYGMSSA-N |
| XLogP | 1.18 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|