C20H24N2O2 — CID 134712464
4-phenyl-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]butanamide (PubChem CID 134712464) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-phenyl-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]butanamide.
| Compound Name | 4-phenyl-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]butanamide |
|---|---|
| PubChem CID | 134712464 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 4-phenyl-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]butanamide |
| SMILES | O=C(CCCc1ccccc1)N[C@@H]1COC[C@H]1Cc1ccncc1 |
| InChI | InChI=1S/C20H24N2O2/c23-20(8-4-7-16-5-2-1-3-6-16)22-19-15-24-14-18(19)13-17-9-11-21-12-10-17/h1-3,5-6,9-12,18-19H,4,7-8,13-15H2,(H,22,23)/t18-,19-/m1/s1 |
| InChIKey | SOIROUZCSKXXLI-RTBURBONSA-N |
| XLogP | 2.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |