C16H24N2O2 — CID 134697099
4-methyl-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]pentanamide (PubChem CID 134697099) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-methyl-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]pentanamide.
| Compound Name | 4-methyl-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]pentanamide |
|---|---|
| PubChem CID | 134697099 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-methyl-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]pentanamide |
| SMILES | CC(C)CCC(=O)N[C@H]1COC[C@H]1Cc1ccncc1 |
| InChI | InChI=1S/C16H24N2O2/c1-12(2)3-4-16(19)18-15-11-20-10-14(15)9-13-5-7-17-8-6-13/h5-8,12,14-15H,3-4,9-11H2,1-2H3,(H,18,19)/t14-,15+/m1/s1 |
| InChIKey | MFQRKZCVLMRDKM-CABCVRRESA-N |
| XLogP | 2.19 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |