C16H21N3O3 — CID 135094092
2-oxo-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]-2-pyrrolidin-1-ylacetamide (PubChem CID 135094092) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-oxo-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]-2-pyrrolidin-1-ylacetamide.
| Compound Name | 2-oxo-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 135094092 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-oxo-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]-2-pyrrolidin-1-ylacetamide |
| SMILES | O=C(N[C@H]1COC[C@H]1Cc1ccncc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C16H21N3O3/c20-15(16(21)19-7-1-2-8-19)18-14-11-22-10-13(14)9-12-3-5-17-6-4-12/h3-6,13-14H,1-2,7-11H2,(H,18,20)/t13-,14+/m1/s1 |
| InChIKey | YWTHEIFBKRWJOW-KGLIPLIRSA-N |
| XLogP | 0.38 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|