C23H30N2O4 — CID 99788841
trans-methyl (1S,3S)-3-ethoxy-2,2-dimethyl-1-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonylamino)cyclobutane-1-carboxylate (PubChem CID 99788841) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is trans-methyl (1S,3S)-3-ethoxy-2,2-dimethyl-1-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonylamino)cyclobutane-1-carboxylate.
| Compound Name | trans-methyl (1S,3S)-3-ethoxy-2,2-dimethyl-1-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonylamino)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 99788841 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | trans-methyl (1S,3S)-3-ethoxy-2,2-dimethyl-1-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonylamino)cyclobutane-1-carboxylate |
| SMILES | CCO[C@H]1C[C@@](NC(=O)c2ccc3[nH]c4c(c3c2)CCCC4)(C(=O)OC)C1(C)C |
| InChI | InChI=1S/C23H30N2O4/c1-5-29-19-13-23(21(27)28-4,22(19,2)3)25-20(26)14-10-11-18-16(12-14)15-8-6-7-9-17(15)24-18/h10-12,19,24H,5-9,13H2,1-4H3,(H,25,26)/t19-,23+/m0/s1 |
| InChIKey | XPFKNMWPEVOPML-WMZHIEFXSA-N |
| XLogP | 3.52 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|