C19H24N2O4 — CID 71931226
methyl 2-[2-methoxyethyl(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]acetate (PubChem CID 71931226) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is methyl 2-[2-methoxyethyl(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]acetate.
| Compound Name | methyl 2-[2-methoxyethyl(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 71931226 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | methyl 2-[2-methoxyethyl(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]acetate |
| SMILES | COCCN(CC(=O)OC)C(=O)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C19H24N2O4/c1-24-10-9-21(12-18(22)25-2)19(23)13-7-8-17-15(11-13)14-5-3-4-6-16(14)20-17/h7-8,11,20H,3-6,9-10,12H2,1-2H3 |
| InChIKey | CGOFHNCWIKCLAQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|