C17H22N2O7 — CID 120700079
3-ethoxy-1-[(3-methoxy-4-nitrobenzoyl)amino]-2,2-dimethylcyclobutane-1-carboxylic acid (PubChem CID 120700079) has the molecular formula C17H22N2O7 and a molecular weight of 366.37 g/mol. Its IUPAC name is 3-ethoxy-1-[(3-methoxy-4-nitrobenzoyl)amino]-2,2-dimethylcyclobutane-1-carboxylic acid.
| Compound Name | 3-ethoxy-1-[(3-methoxy-4-nitrobenzoyl)amino]-2,2-dimethylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120700079 |
| Molecular Formula | C17H22N2O7 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-ethoxy-1-[(3-methoxy-4-nitrobenzoyl)amino]-2,2-dimethylcyclobutane-1-carboxylic acid |
| SMILES | CCOC1CC(NC(=O)c2ccc([N+](=O)[O-])c(OC)c2)(C(=O)O)C1(C)C |
| InChI | InChI=1S/C17H22N2O7/c1-5-26-13-9-17(15(21)22,16(13,2)3)18-14(20)10-6-7-11(19(23)24)12(8-10)25-4/h6-8,13H,5,9H2,1-4H3,(H,18,20)(H,21,22) |
| InChIKey | MEXICKVMSJQQBZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|