C18H24N2O6 — CID 120699476
3-ethoxy-1-[(4-ethyl-3-nitrobenzoyl)amino]-2,2-dimethylcyclobutane-1-carboxylic acid (PubChem CID 120699476) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-ethoxy-1-[(4-ethyl-3-nitrobenzoyl)amino]-2,2-dimethylcyclobutane-1-carboxylic acid.
| Compound Name | 3-ethoxy-1-[(4-ethyl-3-nitrobenzoyl)amino]-2,2-dimethylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120699476 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 3-ethoxy-1-[(4-ethyl-3-nitrobenzoyl)amino]-2,2-dimethylcyclobutane-1-carboxylic acid |
| SMILES | CCOC1CC(NC(=O)c2ccc(CC)c([N+](=O)[O-])c2)(C(=O)O)C1(C)C |
| InChI | InChI=1S/C18H24N2O6/c1-5-11-7-8-12(9-13(11)20(24)25)15(21)19-18(16(22)23)10-14(26-6-2)17(18,3)4/h7-9,14H,5-6,10H2,1-4H3,(H,19,21)(H,22,23) |
| InChIKey | BTVRSFACXJCASU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|