C18H25N3O3 — CID 154817545
1-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-methoxyphenyl)urea (PubChem CID 154817545) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 154817545 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)N[C@H]2C[C@H]3CO[C@@H](C4CC4)CN3C2)c1 |
| InChI | InChI=1S/C18H25N3O3/c1-23-16-4-2-3-13(8-16)19-18(22)20-14-7-15-11-24-17(12-5-6-12)10-21(15)9-14/h2-4,8,12,14-15,17H,5-7,9-11H2,1H3,(H2,19,20,22)/t14-,15-,17+/m0/s1 |
| InChIKey | PEXAETFUPSXQRN-YQQAZPJKSA-N |
| XLogP | 2.07 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |