C17H23FN2O2 — CID 155492169
N-[(3R,7R,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-fluorobenzamide (PubChem CID 155492169) has the molecular formula C17H23FN2O2 and a molecular weight of 306.38 g/mol. Its IUPAC name is N-[(3R,7R,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-fluorobenzamide.
| Compound Name | N-[(3R,7R,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 155492169 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-[(3R,7R,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-fluorobenzamide |
| SMILES | CC(C)[C@@H]1CN2C[C@H](NC(=O)c3cccc(F)c3)C[C@H]2CO1 |
| InChI | InChI=1S/C17H23FN2O2/c1-11(2)16-9-20-8-14(7-15(20)10-22-16)19-17(21)12-4-3-5-13(18)6-12/h3-6,11,14-16H,7-10H2,1-2H3,(H,19,21)/t14-,15+,16+/m1/s1 |
| InChIKey | MSOSQHIHTBNRTI-PMPSAXMXSA-N |
| XLogP | 2.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |