C24H30N2O2 — CID 155494870
N-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(4-phenylphenyl)acetamide (PubChem CID 155494870) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 155494870 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(4-phenylphenyl)acetamide |
| SMILES | CC(C)[C@@H]1CN2C[C@@H](NC(=O)Cc3ccc(-c4ccccc4)cc3)C[C@H]2CO1 |
| InChI | InChI=1S/C24H30N2O2/c1-17(2)23-15-26-14-21(13-22(26)16-28-23)25-24(27)12-18-8-10-20(11-9-18)19-6-4-3-5-7-19/h3-11,17,21-23H,12-16H2,1-2H3,(H,25,27)/t21-,22-,23-/m0/s1 |
| InChIKey | TUWSXGJFIFMDPA-VABKMULXSA-N |
| XLogP | 3.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |