C18H26FN3O2 — CID 155503831
1-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-[(3-fluorophenyl)methyl]urea (PubChem CID 155503831) has the molecular formula C18H26FN3O2 and a molecular weight of 335.42 g/mol. Its IUPAC name is 1-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-[(3-fluorophenyl)methyl]urea.
| Compound Name | 1-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-[(3-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 155503831 |
| Molecular Formula | C18H26FN3O2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-[(3-fluorophenyl)methyl]urea |
| SMILES | CC(C)[C@@H]1CN2C[C@@H](NC(=O)NCc3cccc(F)c3)C[C@H]2CO1 |
| InChI | InChI=1S/C18H26FN3O2/c1-12(2)17-10-22-9-15(7-16(22)11-24-17)21-18(23)20-8-13-4-3-5-14(19)6-13/h3-6,12,15-17H,7-11H2,1-2H3,(H2,20,21,23)/t15-,16-,17-/m0/s1 |
| InChIKey | JTLXWAAASVCJDC-ULQDDVLXSA-N |
| XLogP | 2.12 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |