C22H31N3O3 — CID 155494928
N-[4-[2-[[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]amino]-2-oxoethyl]phenyl]cyclopropanecarboxamide (PubChem CID 155494928) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[4-[2-[[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]amino]-2-oxoethyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[2-[[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]amino]-2-oxoethyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 155494928 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[4-[2-[[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]amino]-2-oxoethyl]phenyl]cyclopropanecarboxamide |
| SMILES | CC(C)[C@@H]1CN2C[C@@H](NC(=O)Cc3ccc(NC(=O)C4CC4)cc3)C[C@H]2CO1 |
| InChI | InChI=1S/C22H31N3O3/c1-14(2)20-12-25-11-18(10-19(25)13-28-20)23-21(26)9-15-3-7-17(8-4-15)24-22(27)16-5-6-16/h3-4,7-8,14,16,18-20H,5-6,9-13H2,1-2H3,(H,23,26)(H,24,27)/t18-,19-,20-/m0/s1 |
| InChIKey | CWIRHRPEZUZQME-UFYCRDLUSA-N |
| XLogP | 2.19 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |