C22H35N3O — CID 155495746
(3R,7R,8aS)-N-(1-benzylpiperidin-4-yl)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine (PubChem CID 155495746) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is (3R,7R,8aS)-N-(1-benzylpiperidin-4-yl)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine.
| Compound Name | (3R,7R,8aS)-N-(1-benzylpiperidin-4-yl)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
|---|---|
| PubChem CID | 155495746 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | (3R,7R,8aS)-N-(1-benzylpiperidin-4-yl)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
| SMILES | CC(C)[C@@H]1CN2C[C@H](NC3CCN(Cc4ccccc4)CC3)C[C@H]2CO1 |
| InChI | InChI=1S/C22H35N3O/c1-17(2)22-15-25-14-20(12-21(25)16-26-22)23-19-8-10-24(11-9-19)13-18-6-4-3-5-7-18/h3-7,17,19-23H,8-16H2,1-2H3/t20-,21+,22+/m1/s1 |
| InChIKey | XXDJKLMEAQELCK-FSSWDIPSSA-N |
| XLogP | 2.74 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |