C18H22N4O3 — CID 155502753
N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 155502753) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 155502753 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | C[C@H]1CN2C[C@@H](NC(=O)c3cc(=O)n(-c4ccccc4)[nH]3)C[C@H]2CO1 |
| InChI | InChI=1S/C18H22N4O3/c1-12-9-21-10-13(7-15(21)11-25-12)19-18(24)16-8-17(23)22(20-16)14-5-3-2-4-6-14/h2-6,8,12-13,15,20H,7,9-11H2,1H3,(H,19,24)/t12-,13-,15-/m0/s1 |
| InChIKey | UYPTUOYGFNADSO-YDHLFZDLSA-N |
| XLogP | 0.76 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |