C21H30N2O3 — CID 155500234
N-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-methoxy-4-methylphenyl)propanamide (PubChem CID 155500234) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-methoxy-4-methylphenyl)propanamide.
| Compound Name | N-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-methoxy-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 155500234 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | N-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(3-methoxy-4-methylphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)N[C@@H]2C[C@H]3CO[C@@H](C4CC4)CN3C2)ccc1C |
| InChI | InChI=1S/C21H30N2O3/c1-14-3-4-15(9-19(14)25-2)5-8-21(24)22-17-10-18-13-26-20(16-6-7-16)12-23(18)11-17/h3-4,9,16-18,20H,5-8,10-13H2,1-2H3,(H,22,24)/t17-,18+,20-/m1/s1 |
| InChIKey | LAEQRHVKBZGVSK-WSTZPKSXSA-N |
| XLogP | 2.30 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |