C19H28N2O4S — CID 155503072
N-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-ethyl-4-methoxybenzenesulfonamide (PubChem CID 155503072) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-ethyl-4-methoxybenzenesulfonamide.
| Compound Name | N-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-ethyl-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 155503072 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[(3S,7R,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-ethyl-4-methoxybenzenesulfonamide |
| SMILES | CCc1cc(S(=O)(=O)N[C@@H]2C[C@H]3CO[C@@H](C4CC4)CN3C2)ccc1OC |
| InChI | InChI=1S/C19H28N2O4S/c1-3-13-8-17(6-7-18(13)24-2)26(22,23)20-15-9-16-12-25-19(14-4-5-14)11-21(16)10-15/h6-8,14-16,19-20H,3-5,9-12H2,1-2H3/t15-,16+,19-/m1/s1 |
| InChIKey | BXXRZKJEOSCZHD-JTDSTZFVSA-N |
| XLogP | 1.79 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |