C19H28N2O3S — CID 155500727
N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-propan-2-ylbenzenesulfonamide (PubChem CID 155500727) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-propan-2-ylbenzenesulfonamide.
| Compound Name | N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 155500727 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)N[C@H]2C[C@H]3CO[C@@H](C4CC4)CN3C2)cc1 |
| InChI | InChI=1S/C19H28N2O3S/c1-13(2)14-5-7-18(8-6-14)25(22,23)20-16-9-17-12-24-19(15-3-4-15)11-21(17)10-16/h5-8,13,15-17,19-20H,3-4,9-12H2,1-2H3/t16-,17-,19+/m0/s1 |
| InChIKey | WADPUJYLNQGJSP-JENIJYKNSA-N |
| XLogP | 2.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |