C18H26N2O5S — CID 154821710
N-[(3S,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2,3-dihydro-1,4-benzodioxine-5-sulfonamide (PubChem CID 154821710) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2,3-dihydro-1,4-benzodioxine-5-sulfonamide.
| Compound Name | N-[(3S,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2,3-dihydro-1,4-benzodioxine-5-sulfonamide |
|---|---|
| PubChem CID | 154821710 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[(3S,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2,3-dihydro-1,4-benzodioxine-5-sulfonamide |
| SMILES | CC(C)[C@H]1CN2C[C@@H](NS(=O)(=O)c3cccc4c3OCCO4)C[C@H]2CO1 |
| InChI | InChI=1S/C18H26N2O5S/c1-12(2)16-10-20-9-13(8-14(20)11-25-16)19-26(21,22)17-5-3-4-15-18(17)24-7-6-23-15/h3-5,12-14,16,19H,6-11H2,1-2H3/t13-,14-,16+/m0/s1 |
| InChIKey | DJZYMBKKRMCJTP-OFQRWUPVSA-N |
| XLogP | 1.23 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |