C20H21N3O3S — CID 155503424
N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-cyanobenzenesulfonamide (PubChem CID 155503424) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-cyanobenzenesulfonamide.
| Compound Name | N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 155503424 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-cyanobenzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)N[C@H]2C[C@H]3CO[C@@H](c4ccccc4)CN3C2)c1 |
| InChI | InChI=1S/C20H21N3O3S/c21-11-15-5-4-8-19(9-15)27(24,25)22-17-10-18-14-26-20(13-23(18)12-17)16-6-2-1-3-7-16/h1-9,17-18,20,22H,10,12-14H2/t17-,18-,20+/m0/s1 |
| InChIKey | JIWBXPOQLMCUFV-CMKODMSKSA-N |
| XLogP | 2.05 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |