C18H24N4O3S — CID 155495376
N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 155495376) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 155495376 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N[C@@H]1C[C@H]2CO[C@@H](c3ccccc3)CN2C1 |
| InChI | InChI=1S/C18H24N4O3S/c1-12-18(13(2)20-19-12)26(23,24)21-15-8-16-11-25-17(10-22(16)9-15)14-6-4-3-5-7-14/h3-7,15-17,21H,8-11H2,1-2H3,(H,19,20)/t15-,16+,17-/m1/s1 |
| InChIKey | VTXAXUIKIBZGKZ-IXDOHACOSA-N |
| XLogP | 1.52 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |