C19H17ClN2O5S — CID 35569593
6-chloro-N-[(1R,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-4-oxochromene-2-carboxamide (PubChem CID 35569593) has the molecular formula C19H17ClN2O5S and a molecular weight of 420.87 g/mol. Its IUPAC name is 6-chloro-N-[(1R,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-4-oxochromene-2-carboxamide.
| Compound Name | 6-chloro-N-[(1R,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 35569593 |
| Molecular Formula | C19H17ClN2O5S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 6-chloro-N-[(1R,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-4-oxochromene-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H]1N1C(=O)CSC1=O)c1cc(=O)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C19H17ClN2O5S/c20-10-5-6-15-11(7-10)14(23)8-16(27-15)18(25)21-12-3-1-2-4-13(12)22-17(24)9-28-19(22)26/h5-8,12-13H,1-4,9H2,(H,21,25)/t12-,13+/m1/s1 |
| InChIKey | JGTMYBZPWUTASX-OLZOCXBDSA-N |
| XLogP | 3.18 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|