C17H20N2O3S — CID 35569340
N-[(1R,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-4-methylbenzamide (PubChem CID 35569340) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is N-[(1R,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-4-methylbenzamide.
| Compound Name | N-[(1R,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 35569340 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[(1R,2S)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H]2CCCC[C@@H]2N2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-11-6-8-12(9-7-11)16(21)18-13-4-2-3-5-14(13)19-15(20)10-23-17(19)22/h6-9,13-14H,2-5,10H2,1H3,(H,18,21)/t13-,14+/m1/s1 |
| InChIKey | MITCIONKPTXJLD-KGLIPLIRSA-N |
| XLogP | 2.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|