C17H17N3O5S — CID 51896540
N-[(1R,2R)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 51896540) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is N-[(1R,2R)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(1R,2R)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 51896540 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[(1R,2R)-2-(2,4-dioxo-1,3-thiazolidin-3-yl)cyclohexyl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1N1C(=O)CSC1=O)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C17H17N3O5S/c21-15-9-26-17(23)20(15)12-5-2-1-4-10(12)18-16(22)11-8-14(25-19-11)13-6-3-7-24-13/h3,6-8,10,12H,1-2,4-5,9H2,(H,18,22)/t10-,12-/m1/s1 |
| InChIKey | DHBVGTLXMALFQG-ZYHUDNBSSA-N |
| XLogP | 2.67 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|