C13H13N3O4 — CID 62491594
5-(furan-2-yl)-N-(6-oxopiperidin-3-yl)-1,2-oxazole-3-carboxamide (PubChem CID 62491594) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-(6-oxopiperidin-3-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-(6-oxopiperidin-3-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 62491594 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 5-(furan-2-yl)-N-(6-oxopiperidin-3-yl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2cc(-c3ccco3)on2)CN1 |
| InChI | InChI=1S/C13H13N3O4/c17-12-4-3-8(7-14-12)15-13(18)9-6-11(20-16-9)10-2-1-5-19-10/h1-2,5-6,8H,3-4,7H2,(H,14,17)(H,15,18) |
| InChIKey | QKFVDFWNFRRAJE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |