C9H11N3O3 — CID 63663681
N-(6-oxopiperidin-3-yl)-1,2-oxazole-5-carboxamide (PubChem CID 63663681) has the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. Its IUPAC name is N-(6-oxopiperidin-3-yl)-1,2-oxazole-5-carboxamide.
| Compound Name | N-(6-oxopiperidin-3-yl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 63663681 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | N-(6-oxopiperidin-3-yl)-1,2-oxazole-5-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2ccno2)CN1 |
| InChI | InChI=1S/C9H11N3O3/c13-8-2-1-6(5-10-8)12-9(14)7-3-4-11-15-7/h3-4,6H,1-2,5H2,(H,10,13)(H,12,14) |
| InChIKey | JZLIGUKJZDSRHX-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |