C10H13N3O2 — CID 62491246
N-(6-oxopiperidin-3-yl)-1H-pyrrole-2-carboxamide (PubChem CID 62491246) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is N-(6-oxopiperidin-3-yl)-1H-pyrrole-2-carboxamide.
| Compound Name | N-(6-oxopiperidin-3-yl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 62491246 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | N-(6-oxopiperidin-3-yl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2ccc[nH]2)CN1 |
| InChI | InChI=1S/C10H13N3O2/c14-9-4-3-7(6-12-9)13-10(15)8-2-1-5-11-8/h1-2,5,7,11H,3-4,6H2,(H,12,14)(H,13,15) |
| InChIKey | CHQSNRCHWCXLIR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |