C15H21N3O2 — CID 81090519
3-amino-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-5-methoxybenzamide (PubChem CID 81090519) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-amino-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-5-methoxybenzamide.
| Compound Name | 3-amino-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 81090519 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-amino-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-5-methoxybenzamide |
| SMILES | COc1cc(N)cc(C(=O)NC2CCN3CCCC23)c1 |
| InChI | InChI=1S/C15H21N3O2/c1-20-12-8-10(7-11(16)9-12)15(19)17-13-4-6-18-5-2-3-14(13)18/h7-9,13-14H,2-6,16H2,1H3,(H,17,19) |
| InChIKey | IYMQNQQRGYQUAC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|