C12H14Cl3NOS — CID 107966085
2,5-dichloro-N-[[2-(chloromethyl)cyclopentyl]methyl]thiophene-3-carboxamide (PubChem CID 107966085) has the molecular formula C12H14Cl3NOS and a molecular weight of 326.68 g/mol. Its IUPAC name is 2,5-dichloro-N-[[2-(chloromethyl)cyclopentyl]methyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-[[2-(chloromethyl)cyclopentyl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107966085 |
| Molecular Formula | C12H14Cl3NOS |
| Molecular Weight | 326.68 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2,5-dichloro-N-[[2-(chloromethyl)cyclopentyl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NCC1CCCC1CCl)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H14Cl3NOS/c13-5-7-2-1-3-8(7)6-16-12(17)9-4-10(14)18-11(9)15/h4,7-8H,1-3,5-6H2,(H,16,17) |
| InChIKey | ZESIKGDGGCOHAK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.68 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|