C15H19Cl2NO — CID 113273831
N-[[2-(chloromethyl)cyclopentyl]methyl]-2-(4-chlorophenyl)acetamide (PubChem CID 113273831) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is N-[[2-(chloromethyl)cyclopentyl]methyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[[2-(chloromethyl)cyclopentyl]methyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 113273831 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-[[2-(chloromethyl)cyclopentyl]methyl]-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCC1CCCC1CCl |
| InChI | InChI=1S/C15H19Cl2NO/c16-9-12-2-1-3-13(12)10-18-15(19)8-11-4-6-14(17)7-5-11/h4-7,12-13H,1-3,8-10H2,(H,18,19) |
| InChIKey | WRYYABUPISVCKP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|