C16H20Cl2FNO — CID 114307086
2-(2-chloro-6-fluorophenyl)-N-[[2-(chloromethyl)cyclohexyl]methyl]acetamide (PubChem CID 114307086) has the molecular formula C16H20Cl2FNO and a molecular weight of 332.25 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[[2-(chloromethyl)cyclohexyl]methyl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[[2-(chloromethyl)cyclohexyl]methyl]acetamide |
|---|---|
| PubChem CID | 114307086 |
| Molecular Formula | C16H20Cl2FNO |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[[2-(chloromethyl)cyclohexyl]methyl]acetamide |
| SMILES | O=C(Cc1c(F)cccc1Cl)NCC1CCCCC1CCl |
| InChI | InChI=1S/C16H20Cl2FNO/c17-9-11-4-1-2-5-12(11)10-20-16(21)8-13-14(18)6-3-7-15(13)19/h3,6-7,11-12H,1-2,4-5,8-10H2,(H,20,21) |
| InChIKey | SPCRPTXOZXMMQP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|