C10H18ClNO — CID 114306626
N-[[2-(chloromethyl)cyclopentyl]methyl]propanamide (PubChem CID 114306626) has the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. Its IUPAC name is N-[[2-(chloromethyl)cyclopentyl]methyl]propanamide.
| Compound Name | N-[[2-(chloromethyl)cyclopentyl]methyl]propanamide |
|---|---|
| PubChem CID | 114306626 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-[[2-(chloromethyl)cyclopentyl]methyl]propanamide |
| SMILES | CCC(=O)NCC1CCCC1CCl |
| InChI | InChI=1S/C10H18ClNO/c1-2-10(13)12-7-9-5-3-4-8(9)6-11/h8-9H,2-7H2,1H3,(H,12,13) |
| InChIKey | HBIJFWNVKYADPZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|