C15H18F3NO3S — CID 129446532
N-[(1R,2R)-2-[(S)-ethylsulfinyl]cyclohexyl]-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 129446532) has the molecular formula C15H18F3NO3S and a molecular weight of 349.37 g/mol. Its IUPAC name is N-[(1R,2R)-2-[(S)-ethylsulfinyl]cyclohexyl]-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-[(1R,2R)-2-[(S)-ethylsulfinyl]cyclohexyl]-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 129446532 |
| Molecular Formula | C15H18F3NO3S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[(1R,2R)-2-[(S)-ethylsulfinyl]cyclohexyl]-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | CC[S@](=O)[C@@H]1CCCC[C@H]1NC(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C15H18F3NO3S/c1-2-23(22)11-6-4-3-5-10(11)19-15(21)8-7-9(16)13(18)14(20)12(8)17/h7,10-11,20H,2-6H2,1H3,(H,19,21)/t10-,11-,23+/m1/s1 |
| InChIKey | ZLTXXXXITZJUGU-HFXCSBFXSA-N |
| XLogP | 2.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|