C14H25NO3S — CID 110016149
N-(2-ethylsulfinylcyclohexyl)-2-hydroxycyclopentane-1-carboxamide (PubChem CID 110016149) has the molecular formula C14H25NO3S and a molecular weight of 287.43 g/mol. Its IUPAC name is N-(2-ethylsulfinylcyclohexyl)-2-hydroxycyclopentane-1-carboxamide.
| Compound Name | N-(2-ethylsulfinylcyclohexyl)-2-hydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 110016149 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-(2-ethylsulfinylcyclohexyl)-2-hydroxycyclopentane-1-carboxamide |
| SMILES | CCS(=O)C1CCCCC1NC(=O)C1CCCC1O |
| InChI | InChI=1S/C14H25NO3S/c1-2-19(18)13-9-4-3-7-11(13)15-14(17)10-6-5-8-12(10)16/h10-13,16H,2-9H2,1H3,(H,15,17) |
| InChIKey | BLPFEGVIBLALJR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |