C15H20FNO3S — CID 124864793
N-[(1R,2R)-2-[(S)-ethylsulfinyl]cyclohexyl]-2-fluoro-6-hydroxybenzamide (PubChem CID 124864793) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is N-[(1R,2R)-2-[(S)-ethylsulfinyl]cyclohexyl]-2-fluoro-6-hydroxybenzamide.
| Compound Name | N-[(1R,2R)-2-[(S)-ethylsulfinyl]cyclohexyl]-2-fluoro-6-hydroxybenzamide |
|---|---|
| PubChem CID | 124864793 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[(1R,2R)-2-[(S)-ethylsulfinyl]cyclohexyl]-2-fluoro-6-hydroxybenzamide |
| SMILES | CC[S@](=O)[C@@H]1CCCC[C@H]1NC(=O)c1c(O)cccc1F |
| InChI | InChI=1S/C15H20FNO3S/c1-2-21(20)13-9-4-3-7-11(13)17-15(19)14-10(16)6-5-8-12(14)18/h5-6,8,11,13,18H,2-4,7,9H2,1H3,(H,17,19)/t11-,13-,21+/m1/s1 |
| InChIKey | CBZKUDZWUPBUBK-FTFVXWMISA-N |
| XLogP | 2.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |