C17H21N3O3S2 — CID 124731154
N-[(1R,2R)-2-[(S)-ethylsulfinyl]cyclohexyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 124731154) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-[(1R,2R)-2-[(S)-ethylsulfinyl]cyclohexyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[(1R,2R)-2-[(S)-ethylsulfinyl]cyclohexyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 124731154 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[(1R,2R)-2-[(S)-ethylsulfinyl]cyclohexyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | CC[S@](=O)[C@@H]1CCCC[C@H]1NC(=O)c1ccc2c(=O)[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C17H21N3O3S2/c1-2-25(23)14-6-4-3-5-12(14)18-15(21)10-7-8-11-13(9-10)19-17(24)20-16(11)22/h7-9,12,14H,2-6H2,1H3,(H,18,21)(H2,19,20,22,24)/t12-,14-,25+/m1/s1 |
| InChIKey | IQDQOFQKWJZHPJ-GLAPUPDPSA-N |
| XLogP | 2.40 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|