C16H19N3O2S — CID 94124775
N-[(1R,3R)-3-methylcyclohexyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 94124775) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[(1R,3R)-3-methylcyclohexyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[(1R,3R)-3-methylcyclohexyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 94124775 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[(1R,3R)-3-methylcyclohexyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | C[C@@H]1CCC[C@@H](NC(=O)c2ccc3c(=O)[nH]c(=S)[nH]c3c2)C1 |
| InChI | InChI=1S/C16H19N3O2S/c1-9-3-2-4-11(7-9)17-14(20)10-5-6-12-13(8-10)18-16(22)19-15(12)21/h5-6,8-9,11H,2-4,7H2,1H3,(H,17,20)(H2,18,19,21,22)/t9-,11-/m1/s1 |
| InChIKey | JNGPJOJEKFKTBX-MWLCHTKSSA-N |
| XLogP | 2.89 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|