C15H21NO — CID 41098153
4-methyl-N-[(1R,3R)-3-methylcyclohexyl]benzamide (PubChem CID 41098153) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-methyl-N-[(1R,3R)-3-methylcyclohexyl]benzamide.
| Compound Name | 4-methyl-N-[(1R,3R)-3-methylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 41098153 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 4-methyl-N-[(1R,3R)-3-methylcyclohexyl]benzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H]2CCC[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C15H21NO/c1-11-6-8-13(9-7-11)15(17)16-14-5-3-4-12(2)10-14/h6-9,12,14H,3-5,10H2,1-2H3,(H,16,17)/t12-,14-/m1/s1 |
| InChIKey | RETFJFAJKJBJAY-TZMCWYRMSA-N |
| XLogP | 3.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |