C15H22N2O2 — CID 28690073
3-amino-4-methoxy-N-[(1R,3S)-3-methylcyclohexyl]benzamide (PubChem CID 28690073) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-amino-4-methoxy-N-[(1R,3S)-3-methylcyclohexyl]benzamide.
| Compound Name | 3-amino-4-methoxy-N-[(1R,3S)-3-methylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 28690073 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-amino-4-methoxy-N-[(1R,3S)-3-methylcyclohexyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2CCC[C@H](C)C2)cc1N |
| InChI | InChI=1S/C15H22N2O2/c1-10-4-3-5-12(8-10)17-15(18)11-6-7-14(19-2)13(16)9-11/h6-7,9-10,12H,3-5,8,16H2,1-2H3,(H,17,18)/t10-,12+/m0/s1 |
| InChIKey | JCVFUDFIFFBDHP-CMPLNLGQSA-N |
| XLogP | 2.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|